C12H13ClN2O4S2 — CID 47028971
N-[1-(5-chlorothiophen-2-yl)ethyl]-5-(methylsulfamoyl)furan-2-carboxamide (PubChem CID 47028971) has the molecular formula C12H13ClN2O4S2 and a molecular weight of 348.83 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-2-yl)ethyl]-5-(methylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-5-(methylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 47028971 |
| Molecular Formula | C12H13ClN2O4S2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | N-[1-(5-chlorothiophen-2-yl)ethyl]-5-(methylsulfamoyl)furan-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC(C)c2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C12H13ClN2O4S2/c1-7(9-4-5-10(13)20-9)15-12(16)8-3-6-11(19-8)21(17,18)14-2/h3-7,14H,1-2H3,(H,15,16) |
| InChIKey | IYHLUNQQKBFMCA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |