C20H24N6O — CID 47029958
2,5-dimethyl-1-pyridin-3-yl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrole-3-carboxamide (PubChem CID 47029958) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 2,5-dimethyl-1-pyridin-3-yl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-pyridin-3-yl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 47029958 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2,5-dimethyl-1-pyridin-3-yl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2nnc3n2CCCCC3)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C20H24N6O/c1-14-11-17(15(2)26(14)16-7-6-9-21-12-16)20(27)22-13-19-24-23-18-8-4-3-5-10-25(18)19/h6-7,9,11-12H,3-5,8,10,13H2,1-2H3,(H,22,27) |
| InChIKey | GQDTWHBMSCBABJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |