C16H23N3O3 — CID 47030724
1-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-2-amine (PubChem CID 47030724) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-2-amine.
| Compound Name | 1-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 47030724 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-pyrazol-1-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-2-amine |
| SMILES | COc1ccc(CNC(C)Cn2cccn2)c(OC)c1OC |
| InChI | InChI=1S/C16H23N3O3/c1-12(11-19-9-5-8-18-19)17-10-13-6-7-14(20-2)16(22-4)15(13)21-3/h5-9,12,17H,10-11H2,1-4H3 |
| InChIKey | JTBKDOGFOGMWOL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |