C16H23F2N3O4S — CID 47032731
1-[4-(difluoromethylsulfonyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)urea (PubChem CID 47032731) has the molecular formula C16H23F2N3O4S and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfonyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[4-(difluoromethylsulfonyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 47032731 |
| Molecular Formula | C16H23F2N3O4S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[4-(difluoromethylsulfonyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)urea |
| SMILES | CC(C)(CNC(=O)Nc1ccc(S(=O)(=O)C(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H23F2N3O4S/c1-16(2,21-7-9-25-10-8-21)11-19-15(22)20-12-3-5-13(6-4-12)26(23,24)14(17)18/h3-6,14H,7-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | DFTVDWQWPQETRV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |