C15H22F2N2O3S — CID 47046016
4-(difluoromethylsulfonyl)-N-(2-methyl-2-morpholin-4-ylpropyl)aniline (PubChem CID 47046016) has the molecular formula C15H22F2N2O3S and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(2-methyl-2-morpholin-4-ylpropyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(2-methyl-2-morpholin-4-ylpropyl)aniline |
|---|---|
| PubChem CID | 47046016 |
| Molecular Formula | C15H22F2N2O3S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(2-methyl-2-morpholin-4-ylpropyl)aniline |
| SMILES | CC(C)(CNc1ccc(S(=O)(=O)C(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C15H22F2N2O3S/c1-15(2,19-7-9-22-10-8-19)11-18-12-3-5-13(6-4-12)23(20,21)14(16)17/h3-6,14,18H,7-11H2,1-2H3 |
| InChIKey | MMXDODQREVKNIX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |