C16H21N3O2 — CID 47036492
N-[2-(2,6-dimethylphenoxy)ethyl]-3-pyrazol-1-ylpropanamide (PubChem CID 47036492) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[2-(2,6-dimethylphenoxy)ethyl]-3-pyrazol-1-ylpropanamide.
| Compound Name | N-[2-(2,6-dimethylphenoxy)ethyl]-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 47036492 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[2-(2,6-dimethylphenoxy)ethyl]-3-pyrazol-1-ylpropanamide |
| SMILES | Cc1cccc(C)c1OCCNC(=O)CCn1cccn1 |
| InChI | InChI=1S/C16H21N3O2/c1-13-5-3-6-14(2)16(13)21-12-9-17-15(20)7-11-19-10-4-8-18-19/h3-6,8,10H,7,9,11-12H2,1-2H3,(H,17,20) |
| InChIKey | WCDABOLKHABVEP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|