C19H18N4O3S — CID 47037218
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-pyrazol-1-ylbenzamide (PubChem CID 47037218) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-pyrazol-1-ylbenzamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-pyrazol-1-ylbenzamide |
|---|---|
| PubChem CID | 47037218 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-pyrazol-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCS2(=O)=O)cc1)c1ccccc1-n1cccn1 |
| InChI | InChI=1S/C19H18N4O3S/c24-19(17-5-1-2-6-18(17)22-12-3-11-20-22)21-15-7-9-16(10-8-15)23-13-4-14-27(23,25)26/h1-3,5-12H,4,13-14H2,(H,21,24) |
| InChIKey | IVBBJAJSFFEKQA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |