C25H27BrN4O3 — CID 4703849
5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 4703849) has the molecular formula C25H27BrN4O3 and a molecular weight of 511.42 g/mol. Its IUPAC name is 5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4703849 |
| Molecular Formula | C25H27BrN4O3 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 5-(3-bromophenyl)-1-[3-(dimethylamino)propyl]-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1cccn2c(C)c(C(O)=C3C(=O)C(=O)N(CCCN(C)C)C3c3cccc(Br)c3)nc12 |
| InChI | InChI=1S/C25H27BrN4O3/c1-15-8-6-12-29-16(2)20(27-24(15)29)22(31)19-21(17-9-5-10-18(26)14-17)30(25(33)23(19)32)13-7-11-28(3)4/h5-6,8-10,12,14,21,31H,7,11,13H2,1-4H3 |
| InChIKey | HPFGMLBZTQOPNL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|