C22H32N4O — CID 47039077
1-tert-butyl-3-cyclopropyl-N-[2-(N-ethyl-3-methylanilino)ethyl]pyrazole-5-carboxamide (PubChem CID 47039077) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-tert-butyl-3-cyclopropyl-N-[2-(N-ethyl-3-methylanilino)ethyl]pyrazole-5-carboxamide.
| Compound Name | 1-tert-butyl-3-cyclopropyl-N-[2-(N-ethyl-3-methylanilino)ethyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 47039077 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1-tert-butyl-3-cyclopropyl-N-[2-(N-ethyl-3-methylanilino)ethyl]pyrazole-5-carboxamide |
| SMILES | CCN(CCNC(=O)c1cc(C2CC2)nn1C(C)(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C22H32N4O/c1-6-25(18-9-7-8-16(2)14-18)13-12-23-21(27)20-15-19(17-10-11-17)24-26(20)22(3,4)5/h7-9,14-15,17H,6,10-13H2,1-5H3,(H,23,27) |
| InChIKey | PEPYCJDSISHEIZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |