C17H20N4O3 — CID 47040079
methyl 3-[[2-(dimethylamino)-3-pyridinyl]methylcarbamoylamino]benzoate (PubChem CID 47040079) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl 3-[[2-(dimethylamino)-3-pyridinyl]methylcarbamoylamino]benzoate.
| Compound Name | methyl 3-[[2-(dimethylamino)-3-pyridinyl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 47040079 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl 3-[[2-(dimethylamino)-3-pyridinyl]methylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)NCc2cccnc2N(C)C)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-21(2)15-13(7-5-9-18-15)11-19-17(23)20-14-8-4-6-12(10-14)16(22)24-3/h4-10H,11H2,1-3H3,(H2,19,20,23) |
| InChIKey | KVWYMALECQLCPH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |