C17H17FN2O3 — CID 4524189
methyl 3-[(5-fluoro-2-methylphenyl)methylcarbamoylamino]benzoate (PubChem CID 4524189) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is methyl 3-[(5-fluoro-2-methylphenyl)methylcarbamoylamino]benzoate.
| Compound Name | methyl 3-[(5-fluoro-2-methylphenyl)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 4524189 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | methyl 3-[(5-fluoro-2-methylphenyl)methylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)NCc2cc(F)ccc2C)c1 |
| InChI | InChI=1S/C17H17FN2O3/c1-11-6-7-14(18)8-13(11)10-19-17(22)20-15-5-3-4-12(9-15)16(21)23-2/h3-9H,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | LKTMFZKFHCZCBA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |