C22H22N4O3 — CID 47040148
ethyl (E)-3-[4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]phenyl]prop-2-enoate (PubChem CID 47040148) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 47040148 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | ethyl (E)-3-[4-[(4-pyrazol-1-ylphenyl)methylcarbamoylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)NCc2ccc(-n3cccn3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-2-29-21(27)13-8-17-4-9-19(10-5-17)25-22(28)23-16-18-6-11-20(12-7-18)26-15-3-14-24-26/h3-15H,2,16H2,1H3,(H2,23,25,28)/b13-8+ |
| InChIKey | CMXFZHGZNUWILR-MDWZMJQESA-N |
| XLogP | 3.77 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|