C22H22N6O2 — CID 55836595
1-[3-(2-pyrazol-1-ylethoxy)phenyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea (PubChem CID 55836595) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[3-(2-pyrazol-1-ylethoxy)phenyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea.
| Compound Name | 1-[3-(2-pyrazol-1-ylethoxy)phenyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 55836595 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[3-(2-pyrazol-1-ylethoxy)phenyl]-3-[(4-pyrazol-1-ylphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(-n2cccn2)cc1)Nc1cccc(OCCn2cccn2)c1 |
| InChI | InChI=1S/C22H22N6O2/c29-22(23-17-18-6-8-20(9-7-18)28-13-3-11-25-28)26-19-4-1-5-21(16-19)30-15-14-27-12-2-10-24-27/h1-13,16H,14-15,17H2,(H2,23,26,29) |
| InChIKey | NNMFCPRVKXHONP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |