C16H20N2O3S — CID 47040152
ethyl (E)-3-[4-(thiomorpholine-4-carbonylamino)phenyl]prop-2-enoate (PubChem CID 47040152) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl (E)-3-[4-(thiomorpholine-4-carbonylamino)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(thiomorpholine-4-carbonylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 47040152 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | ethyl (E)-3-[4-(thiomorpholine-4-carbonylamino)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-21-15(19)8-5-13-3-6-14(7-4-13)17-16(20)18-9-11-22-12-10-18/h3-8H,2,9-12H2,1H3,(H,17,20)/b8-5+ |
| InChIKey | YKUJHTWBTBAJOO-VMPITWQZSA-N |
| XLogP | 2.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|