C22H25N3O4 — CID 47040204
ethyl (E)-3-[4-[[4-(4-hydroxyphenyl)piperazine-1-carbonyl]amino]phenyl]prop-2-enoate (PubChem CID 47040204) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl (E)-3-[4-[[4-(4-hydroxyphenyl)piperazine-1-carbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[[4-(4-hydroxyphenyl)piperazine-1-carbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 47040204 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | ethyl (E)-3-[4-[[4-(4-hydroxyphenyl)piperazine-1-carbonyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(NC(=O)N2CCN(c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-2-29-21(27)12-5-17-3-6-18(7-4-17)23-22(28)25-15-13-24(14-16-25)19-8-10-20(26)11-9-19/h3-12,26H,2,13-16H2,1H3,(H,23,28)/b12-5+ |
| InChIKey | ZBCXHIWFTYKYMJ-LFYBBSHMSA-N |
| XLogP | 3.32 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|