C21H32N2O3S — CID 47040746
3-cyclopentylsulfonyl-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide (PubChem CID 47040746) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 47040746 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]propanamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)CCS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C21H32N2O3S/c1-22(21(24)13-16-27(25,26)20-7-3-4-8-20)17-18-9-11-19(12-10-18)23-14-5-2-6-15-23/h9-12,20H,2-8,13-17H2,1H3 |
| InChIKey | CWNFLPZGTKIPFW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|