C23H34N4O4S — CID 42926849
N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 42926849) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 42926849 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)CCCCC1C2NC(=O)NC2CS1(=O)=O |
| InChI | InChI=1S/C23H34N4O4S/c1-26(15-17-9-11-18(12-10-17)27-13-5-2-6-14-27)21(28)8-4-3-7-20-22-19(16-32(20,30)31)24-23(29)25-22/h9-12,19-20,22H,2-8,13-16H2,1H3,(H2,24,25,29) |
| InChIKey | LTZURHXIERGGEE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|