C22H28N4O4S — CID 47041937
1-[3-(methylsulfamoyl)phenyl]-3-[1-(3-phenylpropanoyl)piperidin-4-yl]urea (PubChem CID 47041937) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 1-[3-(methylsulfamoyl)phenyl]-3-[1-(3-phenylpropanoyl)piperidin-4-yl]urea.
| Compound Name | 1-[3-(methylsulfamoyl)phenyl]-3-[1-(3-phenylpropanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 47041937 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-[3-(methylsulfamoyl)phenyl]-3-[1-(3-phenylpropanoyl)piperidin-4-yl]urea |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)NC2CCN(C(=O)CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H28N4O4S/c1-23-31(29,30)20-9-5-8-19(16-20)25-22(28)24-18-12-14-26(15-13-18)21(27)11-10-17-6-3-2-4-7-17/h2-9,16,18,23H,10-15H2,1H3,(H2,24,25,28) |
| InChIKey | DHUALQXQRGMRSD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |