C13H20N6O2 — CID 47043968
N-(cyclopropylmethyl)-1-[2-(tetrazol-1-yl)acetyl]piperidine-3-carboxamide (PubChem CID 47043968) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-[2-(tetrazol-1-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-1-[2-(tetrazol-1-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47043968 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-(cyclopropylmethyl)-1-[2-(tetrazol-1-yl)acetyl]piperidine-3-carboxamide |
| SMILES | O=C(NCC1CC1)C1CCCN(C(=O)Cn2cnnn2)C1 |
| InChI | InChI=1S/C13H20N6O2/c20-12(8-19-9-15-16-17-19)18-5-1-2-11(7-18)13(21)14-6-10-3-4-10/h9-11H,1-8H2,(H,14,21) |
| InChIKey | ODLREQPOIJALMC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |