C20H23N3O5S — CID 47044380
methyl 2-[[2-[4-[[2-[(5-ethylthiophen-2-yl)methylamino]-2-oxoacetyl]amino]phenyl]acetyl]amino]acetate (PubChem CID 47044380) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is methyl 2-[[2-[4-[[2-[(5-ethylthiophen-2-yl)methylamino]-2-oxoacetyl]amino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[[2-[(5-ethylthiophen-2-yl)methylamino]-2-oxoacetyl]amino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 47044380 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | methyl 2-[[2-[4-[[2-[(5-ethylthiophen-2-yl)methylamino]-2-oxoacetyl]amino]phenyl]acetyl]amino]acetate |
| SMILES | CCc1ccc(CNC(=O)C(=O)Nc2ccc(CC(=O)NCC(=O)OC)cc2)s1 |
| InChI | InChI=1S/C20H23N3O5S/c1-3-15-8-9-16(29-15)11-22-19(26)20(27)23-14-6-4-13(5-7-14)10-17(24)21-12-18(25)28-2/h4-9H,3,10-12H2,1-2H3,(H,21,24)(H,22,26)(H,23,27) |
| InChIKey | JYVMKWMXIVSACV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|