C17H24N2O4 — CID 47044869
methyl 3-[[2-(tert-butylamino)-2-oxoethyl]-ethylcarbamoyl]benzoate (PubChem CID 47044869) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl 3-[[2-(tert-butylamino)-2-oxoethyl]-ethylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[2-(tert-butylamino)-2-oxoethyl]-ethylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 47044869 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | methyl 3-[[2-(tert-butylamino)-2-oxoethyl]-ethylcarbamoyl]benzoate |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-6-19(11-14(20)18-17(2,3)4)15(21)12-8-7-9-13(10-12)16(22)23-5/h7-10H,6,11H2,1-5H3,(H,18,20) |
| InChIKey | IAKZANMQSVETQQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |