C17H25N3O3 — CID 51172752
3-acetamido-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylbenzamide (PubChem CID 51172752) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-acetamido-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylbenzamide.
| Compound Name | 3-acetamido-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 51172752 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-acetamido-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylbenzamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-6-20(11-15(22)19-17(3,4)5)16(23)13-8-7-9-14(10-13)18-12(2)21/h7-10H,6,11H2,1-5H3,(H,18,21)(H,19,22) |
| InChIKey | HJNRWIWVOYCBER-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |