C23H17N3O5S2 — CID 4704527
2-[5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 4704527) has the molecular formula C23H17N3O5S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | 2-[5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 4704527 |
| Molecular Formula | C23H17N3O5S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 2-[5-[(1,3-diphenylpyrazol-4-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)N1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2ccccc2)SC1=S |
| InChI | InChI=1S/C23H17N3O5S2/c27-19(28)12-17(22(30)31)26-21(29)18(33-23(26)32)11-15-13-25(16-9-5-2-6-10-16)24-20(15)14-7-3-1-4-8-14/h1-11,13,17H,12H2,(H,27,28)(H,30,31) |
| InChIKey | FDPDAXMJFXPXHJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|