C28H20FN3O3S2 — CID 71453115
(2R)-2-[(5Z)-5-[[3-(2-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 71453115) has the molecular formula C28H20FN3O3S2 and a molecular weight of 529.62 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[[3-(2-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[(5Z)-5-[[3-(2-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 71453115 |
| Molecular Formula | C28H20FN3O3S2 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | (2R)-2-[(5Z)-5-[[3-(2-fluorophenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)N1C(=O)/C(=C/c2cn(-c3ccccc3)nc2-c2ccccc2F)SC1=S |
| InChI | InChI=1S/C28H20FN3O3S2/c29-22-14-8-7-13-21(22)25-19(17-31(30-25)20-11-5-2-6-12-20)16-24-26(33)32(28(36)37-24)23(27(34)35)15-18-9-3-1-4-10-18/h1-14,16-17,23H,15H2,(H,34,35)/b24-16-/t23-/m1/s1 |
| InChIKey | NPEODYXNQHPLEN-KDYMBEQYSA-N |
| XLogP | 5.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|