C15H17ClN6OS — CID 47045903
5-chloro-1-methyl-2-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole (PubChem CID 47045903) has the molecular formula C15H17ClN6OS and a molecular weight of 364.86 g/mol. Its IUPAC name is 5-chloro-1-methyl-2-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole.
| Compound Name | 5-chloro-1-methyl-2-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole |
|---|---|
| PubChem CID | 47045903 |
| Molecular Formula | C15H17ClN6OS |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 5-chloro-1-methyl-2-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]benzimidazole |
| SMILES | Cn1c(CSc2nnnn2CC2CCCO2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H17ClN6OS/c1-21-13-5-4-10(16)7-12(13)17-14(21)9-24-15-18-19-20-22(15)8-11-3-2-6-23-11/h4-5,7,11H,2-3,6,8-9H2,1H3 |
| InChIKey | QDAABEVLTGTSKW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |