C20H20FNO3 — CID 47047870
N-ethyl-N-[(3-fluorophenyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 47047870) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 47047870 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-5-methoxy-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)c1c(C)oc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H20FNO3/c1-4-22(12-14-6-5-7-15(21)10-14)20(23)19-13(2)25-18-9-8-16(24-3)11-17(18)19/h5-11H,4,12H2,1-3H3 |
| InChIKey | LTCYHXCLWATWGS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |