C24H38N4O4 — CID 47048330
tert-butyl N-[1-[[1-(3-acetamidophenyl)ethylcarbamoylamino]methyl]cycloheptyl]carbamate (PubChem CID 47048330) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3-acetamidophenyl)ethylcarbamoylamino]methyl]cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3-acetamidophenyl)ethylcarbamoylamino]methyl]cycloheptyl]carbamate |
|---|---|
| PubChem CID | 47048330 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | tert-butyl N-[1-[[1-(3-acetamidophenyl)ethylcarbamoylamino]methyl]cycloheptyl]carbamate |
| SMILES | CC(=O)Nc1cccc(C(C)NC(=O)NCC2(NC(=O)OC(C)(C)C)CCCCCC2)c1 |
| InChI | InChI=1S/C24H38N4O4/c1-17(19-11-10-12-20(15-19)27-18(2)29)26-21(30)25-16-24(13-8-6-7-9-14-24)28-22(31)32-23(3,4)5/h10-12,15,17H,6-9,13-14,16H2,1-5H3,(H,27,29)(H,28,31)(H2,25,26,30) |
| InChIKey | KPPNMIXWAWSKAK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |