C21H18BrClN4O3S — CID 4704867
4-(4-bromophenyl)sulfonyl-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazol-5-amine (PubChem CID 4704867) has the molecular formula C21H18BrClN4O3S and a molecular weight of 521.82 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfonyl-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazol-5-amine.
| Compound Name | 4-(4-bromophenyl)sulfonyl-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 4704867 |
| Molecular Formula | C21H18BrClN4O3S |
| Molecular Weight | 521.82 g/mol |
| Exact Mass | 520.00 |
| IUPAC Name | 4-(4-bromophenyl)sulfonyl-2-(4-chlorophenyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazol-5-amine |
| SMILES | O=S(=O)(c1ccc(Br)cc1)c1nc(-c2ccc(Cl)cc2)oc1NCCCn1ccnc1 |
| InChI | InChI=1S/C21H18BrClN4O3S/c22-16-4-8-18(9-5-16)31(28,29)21-20(25-10-1-12-27-13-11-24-14-27)30-19(26-21)15-2-6-17(23)7-3-15/h2-9,11,13-14,25H,1,10,12H2 |
| InChIKey | ZMFFXGMVGSKCQB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.82 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|