C16H17N7O — CID 47048760
1-(1-phenylpyrazol-3-yl)-3-[2-(pyrazin-2-ylamino)ethyl]urea (PubChem CID 47048760) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-(1-phenylpyrazol-3-yl)-3-[2-(pyrazin-2-ylamino)ethyl]urea.
| Compound Name | 1-(1-phenylpyrazol-3-yl)-3-[2-(pyrazin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 47048760 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-(1-phenylpyrazol-3-yl)-3-[2-(pyrazin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1cnccn1)Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H17N7O/c24-16(20-10-9-19-15-12-17-7-8-18-15)21-14-6-11-23(22-14)13-4-2-1-3-5-13/h1-8,11-12H,9-10H2,(H,18,19)(H2,20,21,22,24) |
| InChIKey | KWJZSQCWYJSIAR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|