C9H15N5O — CID 119851728
2-(methylamino)-N-[2-(pyrazin-2-ylamino)ethyl]acetamide (PubChem CID 119851728) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-(pyrazin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-(methylamino)-N-[2-(pyrazin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 119851728 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-(methylamino)-N-[2-(pyrazin-2-ylamino)ethyl]acetamide |
| SMILES | CNCC(=O)NCCNc1cnccn1 |
| InChI | InChI=1S/C9H15N5O/c1-10-7-9(15)14-5-4-13-8-6-11-2-3-12-8/h2-3,6,10H,4-5,7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | IDMKRBOTOMOOKS-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|