C15H22N4O — CID 98718371
2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(pyrazin-2-ylamino)ethyl]acetamide (PubChem CID 98718371) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(pyrazin-2-ylamino)ethyl]acetamide.
| Compound Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(pyrazin-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 98718371 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[2-(pyrazin-2-ylamino)ethyl]acetamide |
| SMILES | O=C(C[C@H]1C[C@H]2CC[C@H]1C2)NCCNc1cnccn1 |
| InChI | InChI=1S/C15H22N4O/c20-15(9-13-8-11-1-2-12(13)7-11)19-6-5-18-14-10-16-3-4-17-14/h3-4,10-13H,1-2,5-9H2,(H,17,18)(H,19,20)/t11-,12-,13+/m0/s1 |
| InChIKey | NDJAYKGYEBSSIL-RWMBFGLXSA-N |
| XLogP | 1.83 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|