C15H26N6O — CID 94099324
1-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]-3-[2-(pyrazin-2-ylamino)ethyl]urea (PubChem CID 94099324) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]-3-[2-(pyrazin-2-ylamino)ethyl]urea.
| Compound Name | 1-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]-3-[2-(pyrazin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 94099324 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]-3-[2-(pyrazin-2-ylamino)ethyl]urea |
| SMILES | C[C@H]1CCCCN1CCNC(=O)NCCNc1cnccn1 |
| InChI | InChI=1S/C15H26N6O/c1-13-4-2-3-10-21(13)11-9-20-15(22)19-8-7-18-14-12-16-5-6-17-14/h5-6,12-13H,2-4,7-11H2,1H3,(H,17,18)(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | VKNOBSARZOFLNN-ZDUSSCGKSA-N |
| XLogP | 1.06 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|