C15H24N4O2 — CID 66457281
methyl 6-[3-(2-methylpiperidin-1-yl)propylamino]pyrazine-2-carboxylate (PubChem CID 66457281) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 6-[3-(2-methylpiperidin-1-yl)propylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 6-[3-(2-methylpiperidin-1-yl)propylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66457281 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | methyl 6-[3-(2-methylpiperidin-1-yl)propylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cncc(NCCCN2CCCCC2C)n1 |
| InChI | InChI=1S/C15H24N4O2/c1-12-6-3-4-8-19(12)9-5-7-17-14-11-16-10-13(18-14)15(20)21-2/h10-12H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | FUDZHPUIPLRXPJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|