C9H17Cl2N5O — CID 119851731
(2R)-2-amino-N-[2-(pyrazin-2-ylamino)ethyl]propanamide;dihydrochloride (PubChem CID 119851731) has the molecular formula C9H17Cl2N5O and a molecular weight of 282.17 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(pyrazin-2-ylamino)ethyl]propanamide;dihydrochloride.
| Compound Name | (2R)-2-amino-N-[2-(pyrazin-2-ylamino)ethyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119851731 |
| Molecular Formula | C9H17Cl2N5O |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (2R)-2-amino-N-[2-(pyrazin-2-ylamino)ethyl]propanamide;dihydrochloride |
| SMILES | C[C@@H](N)C(=O)NCCNc1cnccn1.Cl.Cl |
| InChI | InChI=1S/C9H15N5O.2ClH/c1-7(10)9(15)14-5-4-13-8-6-11-2-3-12-8;;/h2-3,6-7H,4-5,10H2,1H3,(H,12,13)(H,14,15);2*1H/t7-;;/m1../s1 |
| InChIKey | WSVVDRLWGYUBRI-XCUBXKJBSA-N |
| XLogP | 0.20 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|