C10H16N4O — CID 76893313
2-amino-3,3-dimethyl-N-pyrazin-2-ylbutanamide (PubChem CID 76893313) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-amino-3,3-dimethyl-N-pyrazin-2-ylbutanamide.
| Compound Name | 2-amino-3,3-dimethyl-N-pyrazin-2-ylbutanamide |
|---|---|
| PubChem CID | 76893313 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-amino-3,3-dimethyl-N-pyrazin-2-ylbutanamide |
| SMILES | CC(C)(C)C(N)C(=O)Nc1cnccn1 |
| InChI | InChI=1S/C10H16N4O/c1-10(2,3)8(11)9(15)14-7-6-12-4-5-13-7/h4-6,8H,11H2,1-3H3,(H,13,14,15) |
| InChIKey | DVUBINKTBQJRJX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |