C17H22N4O2 — CID 51092705
3-(2,3-dimethylphenoxy)-N-[2-(pyrazin-2-ylamino)ethyl]propanamide (PubChem CID 51092705) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)-N-[2-(pyrazin-2-ylamino)ethyl]propanamide.
| Compound Name | 3-(2,3-dimethylphenoxy)-N-[2-(pyrazin-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 51092705 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)-N-[2-(pyrazin-2-ylamino)ethyl]propanamide |
| SMILES | Cc1cccc(OCCC(=O)NCCNc2cnccn2)c1C |
| InChI | InChI=1S/C17H22N4O2/c1-13-4-3-5-15(14(13)2)23-11-6-17(22)21-10-9-20-16-12-18-7-8-19-16/h3-5,7-8,12H,6,9-11H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | ZBOLTGKPGUSUFM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|