C26H24BrN3O4S — CID 4704977
7-bromo-1-(4-hexoxyphenyl)-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4704977) has the molecular formula C26H24BrN3O4S and a molecular weight of 554.47 g/mol. Its IUPAC name is 7-bromo-1-(4-hexoxyphenyl)-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(4-hexoxyphenyl)-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4704977 |
| Molecular Formula | C26H24BrN3O4S |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 7-bromo-1-(4-hexoxyphenyl)-2-(5-methyl-1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2c2nnc(C)s2)cc1 |
| InChI | InChI=1S/C26H24BrN3O4S/c1-3-4-5-6-13-33-18-10-7-16(8-11-18)22-21-23(31)19-14-17(27)9-12-20(19)34-24(21)25(32)30(22)26-29-28-15(2)35-26/h7-12,14,22H,3-6,13H2,1-2H3 |
| InChIKey | DMOGYJHYTNUJEY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|