C26H21BrN2O4 — CID 4708781
7-bromo-1-(4-butoxyphenyl)-2-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4708781) has the molecular formula C26H21BrN2O4 and a molecular weight of 505.37 g/mol. Its IUPAC name is 7-bromo-1-(4-butoxyphenyl)-2-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(4-butoxyphenyl)-2-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4708781 |
| Molecular Formula | C26H21BrN2O4 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 7-bromo-1-(4-butoxyphenyl)-2-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2c3c(oc4ccc(Br)cc4c3=O)C(=O)N2c2ccccn2)cc1 |
| InChI | InChI=1S/C26H21BrN2O4/c1-2-3-14-32-18-10-7-16(8-11-18)23-22-24(30)19-15-17(27)9-12-20(19)33-25(22)26(31)29(23)21-6-4-5-13-28-21/h4-13,15,23H,2-3,14H2,1H3 |
| InChIKey | OWSGVJVNVUMILW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|