C24H32F3N3O — CID 47052606
1-[4-[[2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrol-3-yl]methylamino]piperidin-1-yl]-2-ethylbutan-1-one (PubChem CID 47052606) has the molecular formula C24H32F3N3O and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[4-[[2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrol-3-yl]methylamino]piperidin-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[4-[[2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrol-3-yl]methylamino]piperidin-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 47052606 |
| Molecular Formula | C24H32F3N3O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[4-[[2,5-dimethyl-1-(2,3,4-trifluorophenyl)pyrrol-3-yl]methylamino]piperidin-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CCC(NCc2cc(C)n(-c3ccc(F)c(F)c3F)c2C)CC1 |
| InChI | InChI=1S/C24H32F3N3O/c1-5-17(6-2)24(31)29-11-9-19(10-12-29)28-14-18-13-15(3)30(16(18)4)21-8-7-20(25)22(26)23(21)27/h7-8,13,17,19,28H,5-6,9-12,14H2,1-4H3 |
| InChIKey | ZMBHKDGNWUMHNR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|