C12H12ClN3OS — CID 470528
6-Chloro-2-[(3-methoxyphenyl)methylsulfanyl]pyrimidin-4-amine (PubChem CID 470528) has the molecular formula C12H12ClN3OS and a molecular weight of 281.76 g/mol. Its IUPAC name is 6-chloro-2-[(3-methoxyphenyl)methylsulfanyl]pyrimidin-4-amine.
| Compound Name | 6-Chloro-2-[(3-methoxyphenyl)methylsulfanyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 470528 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 6-chloro-2-[(3-methoxyphenyl)methylsulfanyl]pyrimidin-4-amine |
| SMILES | COC1=CC=CC(=C1)CSC2=NC(=CC(=N2)Cl)N |
| InChI | InChI=1S/C12H12ClN3OS/c1-17-9-4-2-3-8(5-9)7-18-12-15-10(13)6-11(14)16-12/h2-6H,7H2,1H3,(H2,14,15,16) |
| InChIKey | UNDHAVDDZLESST-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 259 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |