C12H14N4OS — CID 2291042
2-(2-phenoxyethylsulfanyl)pyrimidine-4,6-diamine (PubChem CID 2291042) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-(2-phenoxyethylsulfanyl)pyrimidine-4,6-diamine.
| Compound Name | 2-(2-phenoxyethylsulfanyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 2291042 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(2-phenoxyethylsulfanyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SCCOc2ccccc2)n1 |
| InChI | InChI=1S/C12H14N4OS/c13-10-8-11(14)16-12(15-10)18-7-6-17-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H4,13,14,15,16) |
| InChIKey | HGEZYFPZCBLTMZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|