C18H17N3OS — CID 90681267
2-benzylsulfanyl-6-phenylmethoxypyrimidin-4-amine (PubChem CID 90681267) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-phenylmethoxypyrimidin-4-amine.
| Compound Name | 2-benzylsulfanyl-6-phenylmethoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 90681267 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-benzylsulfanyl-6-phenylmethoxypyrimidin-4-amine |
| SMILES | Nc1cc(OCc2ccccc2)nc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C18H17N3OS/c19-16-11-17(22-12-14-7-3-1-4-8-14)21-18(20-16)23-13-15-9-5-2-6-10-15/h1-11H,12-13H2,(H2,19,20,21) |
| InChIKey | JSOVQNMMVJUMMZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |