C18H20N6O3S — CID 47053484
N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-6-pyrazol-1-ylpyrazin-2-amine (PubChem CID 47053484) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-6-pyrazol-1-ylpyrazin-2-amine.
| Compound Name | N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-6-pyrazol-1-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 47053484 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[(2-morpholin-4-ylsulfonylphenyl)methyl]-6-pyrazol-1-ylpyrazin-2-amine |
| SMILES | O=S(=O)(c1ccccc1CNc1cncc(-n2cccn2)n1)N1CCOCC1 |
| InChI | InChI=1S/C18H20N6O3S/c25-28(26,23-8-10-27-11-9-23)16-5-2-1-4-15(16)12-20-17-13-19-14-18(22-17)24-7-3-6-21-24/h1-7,13-14H,8-12H2,(H,20,22) |
| InChIKey | FXFHZGPIRYXUGN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |