C21H26N6 — CID 47054208
N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-6-pyrazol-1-ylpyrazin-2-amine (PubChem CID 47054208) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-6-pyrazol-1-ylpyrazin-2-amine.
| Compound Name | N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-6-pyrazol-1-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 47054208 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]-6-pyrazol-1-ylpyrazin-2-amine |
| SMILES | CC1CCCN(Cc2ccccc2CNc2cncc(-n3cccn3)n2)C1 |
| InChI | InChI=1S/C21H26N6/c1-17-6-4-10-26(15-17)16-19-8-3-2-7-18(19)12-23-20-13-22-14-21(25-20)27-11-5-9-24-27/h2-3,5,7-9,11,13-14,17H,4,6,10,12,15-16H2,1H3,(H,23,25) |
| InChIKey | HRVMLAIZHCNBHR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |