C25H29N3O4 — CID 47056810
N-[[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]methyl]-6-oxo-6-phenylhexanamide (PubChem CID 47056810) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]methyl]-6-oxo-6-phenylhexanamide.
| Compound Name | N-[[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]methyl]-6-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 47056810 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]methyl]-6-oxo-6-phenylhexanamide |
| SMILES | CC1(C)NC(=O)N(Cc2ccc(CNC(=O)CCCCC(=O)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H29N3O4/c1-25(2)23(31)28(24(32)27-25)17-19-14-12-18(13-15-19)16-26-22(30)11-7-6-10-21(29)20-8-4-3-5-9-20/h3-5,8-9,12-15H,6-7,10-11,16-17H2,1-2H3,(H,26,30)(H,27,32) |
| InChIKey | BDPLJUGCVGDQAC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|