C16H17N5O3 — CID 47057745
N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]imidazo[1,2-a]pyrimidine-2-carboxamide (PubChem CID 47057745) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]imidazo[1,2-a]pyrimidine-2-carboxamide.
| Compound Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]imidazo[1,2-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 47057745 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]imidazo[1,2-a]pyrimidine-2-carboxamide |
| SMILES | COCCOc1ccc(CNC(=O)c2cn3cccnc3n2)cn1 |
| InChI | InChI=1S/C16H17N5O3/c1-23-7-8-24-14-4-3-12(9-18-14)10-19-15(22)13-11-21-6-2-5-17-16(21)20-13/h2-6,9,11H,7-8,10H2,1H3,(H,19,22) |
| InChIKey | AFACSJQNSKJGBC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|