C21H30N4OS — CID 47058889
N-[[1-(3-methylphenyl)cyclohexyl]methyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 47058889) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is N-[[1-(3-methylphenyl)cyclohexyl]methyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[[1-(3-methylphenyl)cyclohexyl]methyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 47058889 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[[1-(3-methylphenyl)cyclohexyl]methyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NCC1(c2cccc(C)c2)CCCCC1 |
| InChI | InChI=1S/C21H30N4OS/c1-3-8-18-23-24-20(27)25(18)14-19(26)22-15-21(11-5-4-6-12-21)17-10-7-9-16(2)13-17/h7,9-10,13H,3-6,8,11-12,14-15H2,1-2H3,(H,22,26)(H,24,27) |
| InChIKey | CSGRTDNKPZCOFV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|