C14H13BrN4O3 — CID 47059548
N-(4-bromophenyl)-3-[(3-nitro-2-pyridinyl)amino]propanamide (PubChem CID 47059548) has the molecular formula C14H13BrN4O3 and a molecular weight of 365.19 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[(3-nitro-2-pyridinyl)amino]propanamide.
| Compound Name | N-(4-bromophenyl)-3-[(3-nitro-2-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 47059548 |
| Molecular Formula | C14H13BrN4O3 |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-(4-bromophenyl)-3-[(3-nitro-2-pyridinyl)amino]propanamide |
| SMILES | O=C(CCNc1ncccc1[N+](=O)[O-])Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H13BrN4O3/c15-10-3-5-11(6-4-10)18-13(20)7-9-17-14-12(19(21)22)2-1-8-16-14/h1-6,8H,7,9H2,(H,16,17)(H,18,20) |
| InChIKey | MKJSADHQWUZVFP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|