C19H25N3O3 — CID 47060692
2-[[bis(oxolan-2-ylmethyl)amino]methyl]phthalazin-1-one (PubChem CID 47060692) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-[[bis(oxolan-2-ylmethyl)amino]methyl]phthalazin-1-one.
| Compound Name | 2-[[bis(oxolan-2-ylmethyl)amino]methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 47060692 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[[bis(oxolan-2-ylmethyl)amino]methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1CN(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C19H25N3O3/c23-19-18-8-2-1-5-15(18)11-20-22(19)14-21(12-16-6-3-9-24-16)13-17-7-4-10-25-17/h1-2,5,8,11,16-17H,3-4,6-7,9-10,12-14H2 |
| InChIKey | QDIGHPLIYHOECA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |