About 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one
2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one (PubChem CID 56810800) has the molecular formula C16H19N3O3S
and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one |
| PubChem CID | 56810800 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1CN(C1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H19N3O3S/c20-16-15-4-2-1-3-12(15)9-17-19(16)11-18(13-5-6-13)14-7-8-23(21,22)10-14/h1-4,9,13-14H,5-8,10-11H2 |
| InChIKey | NDHLKXZVFRQMEM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one?
The IUPAC name of 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one (CID 56810800) is 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one.
What is the SMILES notation for 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one?
The canonical SMILES for 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one is O=c1c2ccccc2cnn1CN(C1CC1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one?
The InChIKey is NDHLKXZVFRQMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3S/c20-16-15-4-2-1-3-12(15)9-17-19(16)11-18(13-5-6-13)14-7-8-23(21,22)10-14/h1-4,9,13-14H,5-8,10-11H2.
What are the key properties of 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one?
2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one has a molecular weight of 333.41 g/mol, XLogP of 1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[cyclopropyl-(1,1-dioxothiolan-3-yl)amino]methyl]phthalazin-1-one is sourced from PubChem (CID 56810800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).